![3,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one (CAS: 3172-99-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0706852.png "3,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one chemical structure")
3,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one
Catalog No: FT-0706852
CAS No: 3172-99-4
- Chemical Name: 3,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one
- Molecular Formula: C17H12O5
- Molecular Weight: 296.27
- InChI Key: PXHLPCBBXPHBHP-UHFFFAOYSA-N
- InChI: InChI=1S/C17H12O5/c1-19-9-3-5-11-13(7-9)21-16-12-6-4-10(20-2)8-14(12)22-17(18)15(11)16/h3-8H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 3172-99-4 |
|---|---|
| MF: | C17H12O5 |
| Density: | 1.355g/cm3 |
| Flash_Point: | 247.8ºC |
| Melting_Point: | N/A |
| Product_Name: | 3,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one |
| Symbol: | GHS07 |
| Bolling_Point: | 486.1ºC at 760 mmHg |
| FW: | 296.27400 |
| Density: | 1.355g/cm3 |
|---|---|
| MF: | C17H12O5 |
| LogP: | 3.70960 |
| Exact_Mass: | 296.06800 |
| Bolling_Point: | 486.1ºC at 760 mmHg |
| Flash_Point: | 247.8ºC |
| FW: | 296.27400 |
| Refractive_Index: | 1.643 |
| PSA: | 61.81000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Safety_Statements: | 26 |
| Symbol: | GHS07 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2932999099 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | 36/37/38 |
